About 3-chloro-1-(3-chloro-2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+)
3-chloro-1-(3-chloro-2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+) (PubChem CID 23311022) has the molecular formula C20H12Cl2O2Ti+2
and a molecular weight of 403.09 g/mol. Its IUPAC name is 3-chloro-1-(3-chloro-2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+).
Molecular Properties
| Compound Name | 3-chloro-1-(3-chloro-2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+) |
| PubChem CID | 23311022 |
| Molecular Formula | C20H12Cl2O2Ti+2 |
| Molecular Weight | 403.09 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | 3-chloro-1-(3-chloro-2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+) |
| SMILES | Oc1c(Cl)cc2ccccc2c1-c1c(O)c(Cl)cc2ccccc12.[Ti+2] |
| InChI | InChI=1S/C20H12Cl2O2.Ti/c21-15-9-11-5-1-3-7-13(11)17(19(15)23)18-14-8-4-2-6-12(14)10-16(22)20(18)24;/h1-10,23-24H;/q;+2 |
| InChIKey | GWBLCEFCSQZHJL-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 403.09 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chloro-1-(3-chloro-2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1-(3-chloro-2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+)?
The IUPAC name of 3-chloro-1-(3-chloro-2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+) (CID 23311022) is 3-chloro-1-(3-chloro-2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+).
What is the SMILES notation for 3-chloro-1-(3-chloro-2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+)?
The canonical SMILES for 3-chloro-1-(3-chloro-2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+) is Oc1c(Cl)cc2ccccc2c1-c1c(O)c(Cl)cc2ccccc12.[Ti+2].
What is the InChIKey of 3-chloro-1-(3-chloro-2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+)?
The InChIKey is GWBLCEFCSQZHJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12Cl2O2.Ti/c21-15-9-11-5-1-3-7-13(11)17(19(15)23)18-14-8-4-2-6-12(14)10-16(22)20(18)24;/h1-10,23-24H;/q;+2.
What are the key properties of 3-chloro-1-(3-chloro-2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+)?
3-chloro-1-(3-chloro-2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+) has a molecular weight of 403.09 g/mol, XLogP of 6.38, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1-(3-chloro-2-hydroxynaphthalen-1-yl)naphthalen-2-ol;titanium(2+) is sourced from PubChem (CID 23311022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).