About dichlorotitanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol
dichlorotitanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol (PubChem CID 58639284) has the molecular formula C32H22Cl2O2Ti
and a molecular weight of 557.30 g/mol. Its IUPAC name is dichlorotitanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol.
Molecular Properties
| Compound Name | dichlorotitanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol |
| PubChem CID | 58639284 |
| Molecular Formula | C32H22Cl2O2Ti |
| Molecular Weight | 557.30 g/mol |
| Exact Mass | 556.05 |
| IUPAC Name | dichlorotitanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol |
| SMILES | Cl[Ti]Cl.Oc1c(-c2ccccc2)cc2ccccc2c1-c1c(O)c(-c2ccccc2)cc2ccccc12 |
| InChI | InChI=1S/C32H22O2.2ClH.Ti/c33-31-27(21-11-3-1-4-12-21)19-23-15-7-9-17-25(23)29(31)30-26-18-10-8-16-24(26)20-28(32(30)34)22-13-5-2-6-14-22;;;/h1-20,33-34H;2*1H;/q;;;+2/p-2 |
| InChIKey | NXQKFDGTHYSCFH-UHFFFAOYSA-L |
| XLogP | 9.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 557.30 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dichlorotitanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorotitanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol?
The IUPAC name of dichlorotitanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol (CID 58639284) is dichlorotitanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol.
What is the SMILES notation for dichlorotitanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol?
The canonical SMILES for dichlorotitanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol is Cl[Ti]Cl.Oc1c(-c2ccccc2)cc2ccccc2c1-c1c(O)c(-c2ccccc2)cc2ccccc12.
What is the InChIKey of dichlorotitanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol?
The InChIKey is NXQKFDGTHYSCFH-UHFFFAOYSA-L. The full InChI is InChI=1S/C32H22O2.2ClH.Ti/c33-31-27(21-11-3-1-4-12-21)19-23-15-7-9-17-25(23)29(31)30-26-18-10-8-16-24(26)20-28(32(30)34)22-13-5-2-6-14-22;;;/h1-20,33-34H;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorotitanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol?
dichlorotitanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol has a molecular weight of 557.30 g/mol, XLogP of 9.78, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorotitanium;1-(2-hydroxy-3-phenylnaphthalen-1-yl)-3-phenylnaphthalen-2-ol is sourced from PubChem (CID 58639284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).