C32H24O3Si — CID 139037456
12,12-dihydroxy-10,14-diphenyl-12-silapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene;hydrate (PubChem CID 139037456) has the molecular formula C32H24O3Si and a molecular weight of 484.63 g/mol. Its IUPAC name is 12,12-dihydroxy-10,14-diphenyl-12-silapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene;hydrate.
| Compound Name | 12,12-dihydroxy-10,14-diphenyl-12-silapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene;hydrate |
|---|---|
| PubChem CID | 139037456 |
| Molecular Formula | C32H24O3Si |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 12,12-dihydroxy-10,14-diphenyl-12-silapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene;hydrate |
| SMILES | O.O[Si]1(O)c2c(-c3ccccc3)cc3ccccc3c2-c2c1c(-c1ccccc1)cc1ccccc21 |
| InChI | InChI=1S/C32H22O2Si.H2O/c33-35(34)31-27(21-11-3-1-4-12-21)19-23-15-7-9-17-25(23)29(31)30-26-18-10-8-16-24(26)20-28(32(30)35)22-13-5-2-6-14-22;/h1-20,33-34H;1H2 |
| InChIKey | YGHHFVBDWODICP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|