C14H10O2S — CID 13349667
5-hydroxy-7-methylsulfanyltricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9,11-hexaen-6-one (PubChem CID 13349667) has the molecular formula C14H10O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is 5-hydroxy-7-methylsulfanyltricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9,11-hexaen-6-one.
| Compound Name | 5-hydroxy-7-methylsulfanyltricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9,11-hexaen-6-one |
|---|---|
| PubChem CID | 13349667 |
| Molecular Formula | C14H10O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 5-hydroxy-7-methylsulfanyltricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9,11-hexaen-6-one |
| SMILES | CSc1c(=O)c(O)c2ccc3ccccc1c32 |
| InChI | InChI=1S/C14H10O2S/c1-17-14-10-5-3-2-4-8-6-7-9(11(8)10)12(15)13(14)16/h2-7,15H,1H3 |
| InChIKey | MHFFVTLWEKXPGQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azulene(4)', 'substructure': 'N/A'} |
|---|