C16H8O4 — CID 137225199
4,5-dihydroxypyrene-1,2-dione (PubChem CID 137225199) has the molecular formula C16H8O4 and a molecular weight of 264.24 g/mol. Its IUPAC name is 4,5-dihydroxypyrene-1,2-dione.
| Compound Name | 4,5-dihydroxypyrene-1,2-dione |
|---|---|
| PubChem CID | 137225199 |
| Molecular Formula | C16H8O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 4,5-dihydroxypyrene-1,2-dione |
| SMILES | O=c1cc2c(O)c(O)c3cccc4ccc(c1=O)c2c43 |
| InChI | InChI=1S/C16H8O4/c17-11-6-10-13-9(14(11)18)5-4-7-2-1-3-8(12(7)13)15(19)16(10)20/h1-6,19-20H |
| InChIKey | OFKXXSATORKDDU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|