C16H10O4 — CID 144772301
pyrene-4,5,9,10-tetrol (PubChem CID 144772301) has the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. Its IUPAC name is pyrene-4,5,9,10-tetrol.
| Compound Name | pyrene-4,5,9,10-tetrol |
|---|---|
| PubChem CID | 144772301 |
| Molecular Formula | C16H10O4 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | pyrene-4,5,9,10-tetrol |
| SMILES | Oc1c(O)c2cccc3c(O)c(O)c4cccc1c4c23 |
| InChI | InChI=1S/C16H10O4/c17-13-7-3-1-4-8-11(7)12-9(15(13)19)5-2-6-10(12)16(20)14(8)18/h1-6,17-20H |
| InChIKey | XLGMIYBNAPZXCM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|