About anthracene-1,5,9,10-tetrol
anthracene-1,5,9,10-tetrol (PubChem CID 71371518) has the molecular formula C14H10O4
and a molecular weight of 242.23 g/mol. Its IUPAC name is anthracene-1,5,9,10-tetrol.
Molecular Properties
| Compound Name | anthracene-1,5,9,10-tetrol |
| PubChem CID | 71371518 |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | anthracene-1,5,9,10-tetrol |
| SMILES | Oc1cccc2c(O)c3c(O)cccc3c(O)c12 |
| InChI | InChI=1S/C14H10O4/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6,15-18H |
| InChIKey | KVGNRFUTVLFWFS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene-1,5,9,10-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-1,5,9,10-tetrol?
The IUPAC name of anthracene-1,5,9,10-tetrol (CID 71371518) is anthracene-1,5,9,10-tetrol.
What is the SMILES notation for anthracene-1,5,9,10-tetrol?
The canonical SMILES for anthracene-1,5,9,10-tetrol is Oc1cccc2c(O)c3c(O)cccc3c(O)c12.
What is the InChIKey of anthracene-1,5,9,10-tetrol?
The InChIKey is KVGNRFUTVLFWFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O4/c15-9-5-1-3-7-11(9)14(18)8-4-2-6-10(16)12(8)13(7)17/h1-6,15-18H.
What are the key properties of anthracene-1,5,9,10-tetrol?
anthracene-1,5,9,10-tetrol has a molecular weight of 242.23 g/mol, XLogP of 2.82, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-1,5,9,10-tetrol is sourced from PubChem (CID 71371518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).