C14H10O5 — CID 14166820
anthracene-1,4,5,9,10-pentol (PubChem CID 14166820) has the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. Its IUPAC name is anthracene-1,4,5,9,10-pentol.
| Compound Name | anthracene-1,4,5,9,10-pentol |
|---|---|
| PubChem CID | 14166820 |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | anthracene-1,4,5,9,10-pentol |
| SMILES | Oc1cccc2c(O)c3c(O)ccc(O)c3c(O)c12 |
| InChI | InChI=1S/C14H10O5/c15-7-3-1-2-6-10(7)14(19)12-9(17)5-4-8(16)11(12)13(6)18/h1-5,15-19H |
| InChIKey | OLWUYJNNRBLLSV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|