C10H5ClO4 — CID 141499928
3-chloronaphtho[2,3-c]dioxete-4,8-diol (PubChem CID 141499928) has the molecular formula C10H5ClO4 and a molecular weight of 224.60 g/mol. Its IUPAC name is 3-chloronaphtho[2,3-c]dioxete-4,8-diol.
| Compound Name | 3-chloronaphtho[2,3-c]dioxete-4,8-diol |
|---|---|
| PubChem CID | 141499928 |
| Molecular Formula | C10H5ClO4 |
| Molecular Weight | 224.60 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 3-chloronaphtho[2,3-c]dioxete-4,8-diol |
| SMILES | Oc1c2cccc(O)c2c(Cl)c2ooc12 |
| InChI | InChI=1S/C10H5ClO4/c11-7-6-4(2-1-3-5(6)12)8(13)10-9(7)14-15-10/h1-3,12-13H |
| InChIKey | QIINHELXYZGPOZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.60 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |