C21H14ClNO3 — CID 135476168
10-[(4-chlorophenyl)iminomethyl]anthracene-1,8,9-triol (PubChem CID 135476168) has the molecular formula C21H14ClNO3 and a molecular weight of 363.80 g/mol. Its IUPAC name is 10-[(4-chlorophenyl)iminomethyl]anthracene-1,8,9-triol.
| Compound Name | 10-[(4-chlorophenyl)iminomethyl]anthracene-1,8,9-triol |
|---|---|
| PubChem CID | 135476168 |
| Molecular Formula | C21H14ClNO3 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 10-[(4-chlorophenyl)iminomethyl]anthracene-1,8,9-triol |
| SMILES | Oc1cccc2c(/C=N/c3ccc(Cl)cc3)c3cccc(O)c3c(O)c12 |
| InChI | InChI=1S/C21H14ClNO3/c22-12-7-9-13(10-8-12)23-11-16-14-3-1-5-17(24)19(14)21(26)20-15(16)4-2-6-18(20)25/h1-11,24-26H/b23-11+ |
| InChIKey | XLOQXMJNLDVRGZ-FOKLQQMPSA-N |
| XLogP | 5.51 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|