C22H15NO5 — CID 135419334
10-(1,3-benzodioxol-5-yliminomethyl)anthracene-1,8,9-triol (PubChem CID 135419334) has the molecular formula C22H15NO5 and a molecular weight of 373.36 g/mol. Its IUPAC name is 10-(1,3-benzodioxol-5-yliminomethyl)anthracene-1,8,9-triol.
| Compound Name | 10-(1,3-benzodioxol-5-yliminomethyl)anthracene-1,8,9-triol |
|---|---|
| PubChem CID | 135419334 |
| Molecular Formula | C22H15NO5 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 10-(1,3-benzodioxol-5-yliminomethyl)anthracene-1,8,9-triol |
| SMILES | Oc1cccc2c(/C=N/c3ccc4c(c3)OCO4)c3cccc(O)c3c(O)c12 |
| InChI | InChI=1S/C22H15NO5/c24-16-5-1-3-13-15(10-23-12-7-8-18-19(9-12)28-11-27-18)14-4-2-6-17(25)21(14)22(26)20(13)16/h1-10,24-26H,11H2/b23-10+ |
| InChIKey | JIYFXFUOCRCURP-AUEPDCJTSA-N |
| XLogP | 4.59 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|