C20H14BrN3O3 — CID 170650888
2-(1,3-benzodioxol-5-yliminomethyl)-4-[(3-bromophenyl)diazenyl]phenol (PubChem CID 170650888) has the molecular formula C20H14BrN3O3 and a molecular weight of 424.25 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yliminomethyl)-4-[(3-bromophenyl)diazenyl]phenol.
| Compound Name | 2-(1,3-benzodioxol-5-yliminomethyl)-4-[(3-bromophenyl)diazenyl]phenol |
|---|---|
| PubChem CID | 170650888 |
| Molecular Formula | C20H14BrN3O3 |
| Molecular Weight | 424.25 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yliminomethyl)-4-[(3-bromophenyl)diazenyl]phenol |
| SMILES | Oc1ccc(/N=N/c2cccc(Br)c2)cc1/C=N/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H14BrN3O3/c21-14-2-1-3-16(9-14)23-24-17-4-6-18(25)13(8-17)11-22-15-5-7-19-20(10-15)27-12-26-19/h1-11,25H,12H2/b22-11+,24-23+ |
| InChIKey | AWWOQBWLGHZRQL-YRDALPOASA-N |
| XLogP | 6.05 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.25 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|