C22H17BrN4OS — CID 135504179
4-[(3-bromophenyl)diazenyl]-2-[(E)-(4,6-dimethyl-1,3-benzothiazol-2-yl)iminomethyl]phenol (PubChem CID 135504179) has the molecular formula C22H17BrN4OS and a molecular weight of 465.38 g/mol. Its IUPAC name is 4-[(3-bromophenyl)diazenyl]-2-[(E)-(4,6-dimethyl-1,3-benzothiazol-2-yl)iminomethyl]phenol.
| Compound Name | 4-[(3-bromophenyl)diazenyl]-2-[(E)-(4,6-dimethyl-1,3-benzothiazol-2-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135504179 |
| Molecular Formula | C22H17BrN4OS |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | 4-[(3-bromophenyl)diazenyl]-2-[(E)-(4,6-dimethyl-1,3-benzothiazol-2-yl)iminomethyl]phenol |
| SMILES | Cc1cc(C)c2nc(/N=C/c3cc(/N=N/c4cccc(Br)c4)ccc3O)sc2c1 |
| InChI | InChI=1S/C22H17BrN4OS/c1-13-8-14(2)21-20(9-13)29-22(25-21)24-12-15-10-18(6-7-19(15)28)27-26-17-5-3-4-16(23)11-17/h3-12,28H,1-2H3/b24-12+,27-26+ |
| InChIKey | RQPQKYUCGHYHBZ-SMUXYBERSA-N |
| XLogP | 7.55 |
| TPSA | 70.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|