C27H20N6O2S — CID 135428409
4-(1,3-benzothiazol-2-yldiazenyl)-2-[[5-hydroxy-2-[(2-methylphenyl)diazenyl]phenyl]iminomethyl]phenol (PubChem CID 135428409) has the molecular formula C27H20N6O2S and a molecular weight of 492.56 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yldiazenyl)-2-[[5-hydroxy-2-[(2-methylphenyl)diazenyl]phenyl]iminomethyl]phenol.
| Compound Name | 4-(1,3-benzothiazol-2-yldiazenyl)-2-[[5-hydroxy-2-[(2-methylphenyl)diazenyl]phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135428409 |
| Molecular Formula | C27H20N6O2S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yldiazenyl)-2-[[5-hydroxy-2-[(2-methylphenyl)diazenyl]phenyl]iminomethyl]phenol |
| SMILES | Cc1ccccc1/N=N/c1ccc(O)cc1/N=C/c1cc(/N=N/c2nc3ccccc3s2)ccc1O |
| InChI | InChI=1S/C27H20N6O2S/c1-17-6-2-3-7-21(17)31-32-22-12-11-20(34)15-24(22)28-16-18-14-19(10-13-25(18)35)30-33-27-29-23-8-4-5-9-26(23)36-27/h2-16,34-35H,1H3/b28-16+,32-31+,33-30+ |
| InChIKey | QOERVMUVRIUGMW-FFNPCXBMSA-N |
| XLogP | 8.60 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|