C21H18BrN3O — CID 137242238
4-[(2-bromophenyl)diazenyl]-2-[(3,4-dimethylphenyl)iminomethyl]phenol (PubChem CID 137242238) has the molecular formula C21H18BrN3O and a molecular weight of 408.30 g/mol. Its IUPAC name is 4-[(2-bromophenyl)diazenyl]-2-[(3,4-dimethylphenyl)iminomethyl]phenol.
| Compound Name | 4-[(2-bromophenyl)diazenyl]-2-[(3,4-dimethylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 137242238 |
| Molecular Formula | C21H18BrN3O |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 4-[(2-bromophenyl)diazenyl]-2-[(3,4-dimethylphenyl)iminomethyl]phenol |
| SMILES | Cc1ccc(/N=C/c2cc(/N=N/c3ccccc3Br)ccc2O)cc1C |
| InChI | InChI=1S/C21H18BrN3O/c1-14-7-8-17(11-15(14)2)23-13-16-12-18(9-10-21(16)26)24-25-20-6-4-3-5-19(20)22/h3-13,26H,1-2H3/b23-13+,25-24+ |
| InChIKey | FXDPJONWDLHFDK-JLUADYMRSA-N |
| XLogP | 6.94 |
| TPSA | 57.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|