C20H16ClN3O2 — CID 135810322
2-[[5-[(3-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]-6-methylphenol (PubChem CID 135810322) has the molecular formula C20H16ClN3O2 and a molecular weight of 365.82 g/mol. Its IUPAC name is 2-[[5-[(3-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]-6-methylphenol.
| Compound Name | 2-[[5-[(3-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]-6-methylphenol |
|---|---|
| PubChem CID | 135810322 |
| Molecular Formula | C20H16ClN3O2 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-[[5-[(3-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]-6-methylphenol |
| SMILES | Cc1cccc(/N=C/c2cc(/N=N/c3cccc(Cl)c3)ccc2O)c1O |
| InChI | InChI=1S/C20H16ClN3O2/c1-13-4-2-7-18(20(13)26)22-12-14-10-17(8-9-19(14)25)24-23-16-6-3-5-15(21)11-16/h2-12,25-26H,1H3/b22-12+,24-23+ |
| InChIKey | UKRKTTLIUYSKTM-OBMCKAMCSA-N |
| XLogP | 6.23 |
| TPSA | 77.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|