C29H22N6O2S2 — CID 136723394
2-(1,3-benzothiazol-2-yldiazenyl)-4-[2-[3-(1,3-benzothiazol-2-yldiazenyl)-4-hydroxyphenyl]propan-2-yl]phenol (PubChem CID 136723394) has the molecular formula C29H22N6O2S2 and a molecular weight of 550.67 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yldiazenyl)-4-[2-[3-(1,3-benzothiazol-2-yldiazenyl)-4-hydroxyphenyl]propan-2-yl]phenol.
| Compound Name | 2-(1,3-benzothiazol-2-yldiazenyl)-4-[2-[3-(1,3-benzothiazol-2-yldiazenyl)-4-hydroxyphenyl]propan-2-yl]phenol |
|---|---|
| PubChem CID | 136723394 |
| Molecular Formula | C29H22N6O2S2 |
| Molecular Weight | 550.67 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yldiazenyl)-4-[2-[3-(1,3-benzothiazol-2-yldiazenyl)-4-hydroxyphenyl]propan-2-yl]phenol |
| SMILES | CC(C)(c1ccc(O)c(/N=N/c2nc3ccccc3s2)c1)c1ccc(O)c(/N=N/c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C29H22N6O2S2/c1-29(2,17-11-13-23(36)21(15-17)32-34-27-30-19-7-3-5-9-25(19)38-27)18-12-14-24(37)22(16-18)33-35-28-31-20-8-4-6-10-26(20)39-28/h3-16,36-37H,1-2H3/b34-32+,35-33+ |
| InChIKey | OXSUNHOMLSOMHK-XUXOKTBYSA-N |
| XLogP | 9.47 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.67 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|