C22H26N2OS — CID 5047427
4-(1,3-benzothiazol-2-yliminomethyl)-2,6-ditert-butylphenol (PubChem CID 5047427) has the molecular formula C22H26N2OS and a molecular weight of 366.53 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yliminomethyl)-2,6-ditert-butylphenol.
| Compound Name | 4-(1,3-benzothiazol-2-yliminomethyl)-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 5047427 |
| Molecular Formula | C22H26N2OS |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yliminomethyl)-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(C=Nc2nc3ccccc3s2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C22H26N2OS/c1-21(2,3)15-11-14(12-16(19(15)25)22(4,5)6)13-23-20-24-17-9-7-8-10-18(17)26-20/h7-13,25H,1-6H3 |
| InChIKey | DUZAQPZASPDTEI-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|