C16H9F3N4OS — CID 136867779
3-(1,3-benzothiazol-2-yldiazenyl)-5-(trifluoromethyl)-1H-indol-2-ol (PubChem CID 136867779) has the molecular formula C16H9F3N4OS and a molecular weight of 362.34 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yldiazenyl)-5-(trifluoromethyl)-1H-indol-2-ol.
| Compound Name | 3-(1,3-benzothiazol-2-yldiazenyl)-5-(trifluoromethyl)-1H-indol-2-ol |
|---|---|
| PubChem CID | 136867779 |
| Molecular Formula | C16H9F3N4OS |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yldiazenyl)-5-(trifluoromethyl)-1H-indol-2-ol |
| SMILES | Oc1[nH]c2ccc(C(F)(F)F)cc2c1/N=N/c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H9F3N4OS/c17-16(18,19)8-5-6-10-9(7-8)13(14(24)20-10)22-23-15-21-11-3-1-2-4-12(11)25-15/h1-7,20,24H/b23-22+ |
| InChIKey | MUNZYSWDKOKMGL-GHVJWSGMSA-N |
| XLogP | 5.92 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|