C19H12NO5- — CID 6957315
3-[5-(1,3-benzodioxol-5-yliminomethyl)furan-2-yl]benzoate (PubChem CID 6957315) has the molecular formula C19H12NO5- and a molecular weight of 334.31 g/mol. Its IUPAC name is 3-[5-(1,3-benzodioxol-5-yliminomethyl)furan-2-yl]benzoate.
| Compound Name | 3-[5-(1,3-benzodioxol-5-yliminomethyl)furan-2-yl]benzoate |
|---|---|
| PubChem CID | 6957315 |
| Molecular Formula | C19H12NO5- |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 3-[5-(1,3-benzodioxol-5-yliminomethyl)furan-2-yl]benzoate |
| SMILES | O=C([O-])c1cccc(-c2ccc(/C=N/c3ccc4c(c3)OCO4)o2)c1 |
| InChI | InChI=1S/C19H13NO5/c21-19(22)13-3-1-2-12(8-13)16-7-5-15(25-16)10-20-14-4-6-17-18(9-14)24-11-23-17/h1-10H,11H2,(H,21,22)/p-1/b20-10+ |
| InChIKey | YCUXWIXYKTWRRU-KEBDBYFISA-M |
| XLogP | 2.79 |
| TPSA | 84.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|