C23H17N2O5- — CID 7452639
3-[5-[(Z)-[(1R,2S,6R,7S)-3,5-dioxospiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-4-yl]iminomethyl]furan-2-yl]benzoate (PubChem CID 7452639) has the molecular formula C23H17N2O5- and a molecular weight of 401.40 g/mol. Its IUPAC name is 3-[5-[(Z)-[(1R,2S,6R,7S)-3,5-dioxospiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-4-yl]iminomethyl]furan-2-yl]benzoate.
| Compound Name | 3-[5-[(Z)-[(1R,2S,6R,7S)-3,5-dioxospiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-4-yl]iminomethyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 7452639 |
| Molecular Formula | C23H17N2O5- |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 3-[5-[(Z)-[(1R,2S,6R,7S)-3,5-dioxospiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-4-yl]iminomethyl]furan-2-yl]benzoate |
| SMILES | O=C([O-])c1cccc(-c2ccc(/C=N\N3C(=O)[C@@H]4[C@H](C3=O)[C@@H]3C=C[C@H]4C34CC4)o2)c1 |
| InChI | InChI=1S/C23H18N2O5/c26-20-18-15-5-6-16(23(15)8-9-23)19(18)21(27)25(20)24-11-14-4-7-17(30-14)12-2-1-3-13(10-12)22(28)29/h1-7,10-11,15-16,18-19H,8-9H2,(H,28,29)/p-1/b24-11-/t15-,16+,18+,19- |
| InChIKey | KSYBQTNHXKOQCW-GELIVPSGSA-M |
| XLogP | 1.84 |
| TPSA | 103.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|