C18H19N3O3 — CID 124763448
(1R,2R,6R,7R)-4-[(Z)-[5-(dimethylamino)furan-2-yl]methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione (PubChem CID 124763448) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is (1R,2R,6R,7R)-4-[(Z)-[5-(dimethylamino)furan-2-yl]methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione.
| Compound Name | (1R,2R,6R,7R)-4-[(Z)-[5-(dimethylamino)furan-2-yl]methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione |
|---|---|
| PubChem CID | 124763448 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (1R,2R,6R,7R)-4-[(Z)-[5-(dimethylamino)furan-2-yl]methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione |
| SMILES | CN(C)c1ccc(/C=N\N2C(=O)[C@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C23CC3)o1 |
| InChI | InChI=1S/C18H19N3O3/c1-20(2)13-6-3-10(24-13)9-19-21-16(22)14-11-4-5-12(15(14)17(21)23)18(11)7-8-18/h3-6,9,11-12,14-15H,7-8H2,1-2H3/b19-9-/t11-,12-,14-,15-/m1/s1 |
| InChIKey | MQPYKMPMFZXFNB-HTLPWUQNSA-N |
| XLogP | 1.88 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|