C16H13N3O5 — CID 6541522
(1S,2S,6S,7R)-4-[(Z)-(5-nitrofuran-2-yl)methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione (PubChem CID 6541522) has the molecular formula C16H13N3O5 and a molecular weight of 327.30 g/mol. Its IUPAC name is (1S,2S,6S,7R)-4-[(Z)-(5-nitrofuran-2-yl)methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione.
| Compound Name | (1S,2S,6S,7R)-4-[(Z)-(5-nitrofuran-2-yl)methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione |
|---|---|
| PubChem CID | 6541522 |
| Molecular Formula | C16H13N3O5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (1S,2S,6S,7R)-4-[(Z)-(5-nitrofuran-2-yl)methylideneamino]spiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1/N=C\c1ccc([N+](=O)[O-])o1)[C@@H]1C=C[C@H]2C12CC2 |
| InChI | InChI=1S/C16H13N3O5/c20-14-12-9-2-3-10(16(9)5-6-16)13(12)15(21)18(14)17-7-8-1-4-11(24-8)19(22)23/h1-4,7,9-10,12-13H,5-6H2/b17-7-/t9-,10+,12-,13-/m0/s1 |
| InChIKey | JFKLJLWZHHMEHP-UBNHZHBWSA-N |
| XLogP | 1.72 |
| TPSA | 106.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|