C18H14N3O5- — CID 11905213
2-[(Z)-[(1R,2R,6S,7S)-3,5-dioxospiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-4-yl]iminomethyl]-4-nitrophenolate (PubChem CID 11905213) has the molecular formula C18H14N3O5- and a molecular weight of 352.33 g/mol. Its IUPAC name is 2-[(Z)-[(1R,2R,6S,7S)-3,5-dioxospiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-4-yl]iminomethyl]-4-nitrophenolate.
| Compound Name | 2-[(Z)-[(1R,2R,6S,7S)-3,5-dioxospiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-4-yl]iminomethyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 11905213 |
| Molecular Formula | C18H14N3O5- |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 2-[(Z)-[(1R,2R,6S,7S)-3,5-dioxospiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-4-yl]iminomethyl]-4-nitrophenolate |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1/N=C\c1cc([N+](=O)[O-])ccc1[O-])[C@H]1C=C[C@@H]2C12CC2 |
| InChI | InChI=1S/C18H15N3O5/c22-13-4-1-10(21(25)26)7-9(13)8-19-20-16(23)14-11-2-3-12(15(14)17(20)24)18(11)5-6-18/h1-4,7-8,11-12,14-15,22H,5-6H2/p-1/b19-8-/t11-,12+,14-,15+ |
| InChIKey | AQLAKXNZQADAAK-XKMZPIQTSA-M |
| XLogP | 1.20 |
| TPSA | 115.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|