C30H20N2O5 — CID 2929628
3-[5-[(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)iminomethyl]furan-2-yl]benzoic acid (PubChem CID 2929628) has the molecular formula C30H20N2O5 and a molecular weight of 488.50 g/mol. Its IUPAC name is 3-[5-[(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)iminomethyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)iminomethyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 2929628 |
| Molecular Formula | C30H20N2O5 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 3-[5-[(16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl)iminomethyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2ccc(C=NN3C(=O)C4C5c6ccccc6C(c6ccccc65)C4C3=O)o2)c1 |
| InChI | InChI=1S/C30H20N2O5/c33-28-26-24-19-8-1-2-9-20(19)25(22-11-4-3-10-21(22)24)27(26)29(34)32(28)31-15-18-12-13-23(37-18)16-6-5-7-17(14-16)30(35)36/h1-15,24-27H,(H,35,36) |
| InChIKey | KBCMXYWNHHXGEQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|