C31H22N2O5 — CID 124536940
methyl 2-[5-[(Z)-[(15R,19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]iminomethyl]furan-2-yl]benzoate (PubChem CID 124536940) has the molecular formula C31H22N2O5 and a molecular weight of 502.53 g/mol. Its IUPAC name is methyl 2-[5-[(Z)-[(15R,19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]iminomethyl]furan-2-yl]benzoate.
| Compound Name | methyl 2-[5-[(Z)-[(15R,19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]iminomethyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 124536940 |
| Molecular Formula | C31H22N2O5 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | methyl 2-[5-[(Z)-[(15R,19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]iminomethyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-c1ccc(/C=N\N2C(=O)[C@@H]3C4c5ccccc5C(c5ccccc54)[C@@H]3C2=O)o1 |
| InChI | InChI=1S/C31H22N2O5/c1-37-31(36)23-13-7-2-8-18(23)24-15-14-17(38-24)16-32-33-29(34)27-25-19-9-3-4-10-20(19)26(28(27)30(33)35)22-12-6-5-11-21(22)25/h2-16,25-28H,1H3/b32-16-/t25?,26?,27-,28+ |
| InChIKey | JKWADFWQMNMFOF-IKIWTXHRSA-N |
| XLogP | 4.96 |
| TPSA | 89.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|