C29H18ClN3O5 — CID 126093893
(15R,19R)-17-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 126093893) has the molecular formula C29H18ClN3O5 and a molecular weight of 523.93 g/mol. Its IUPAC name is (15R,19R)-17-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19R)-17-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 126093893 |
| Molecular Formula | C29H18ClN3O5 |
| Molecular Weight | 523.93 g/mol |
| Exact Mass | 523.09 |
| IUPAC Name | (15R,19R)-17-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@@H]2C3c4ccccc4C(c4ccccc43)[C@H]2C(=O)N1/N=C\c1ccc(-c2cc([N+](=O)[O-])ccc2Cl)o1 |
| InChI | InChI=1S/C29H18ClN3O5/c30-22-11-9-15(33(36)37)13-21(22)23-12-10-16(38-23)14-31-32-28(34)26-24-17-5-1-2-6-18(17)25(27(26)29(32)35)20-8-4-3-7-19(20)24/h1-14,24-27H/b31-14-/t24?,25?,26-,27-/m1/s1 |
| InChIKey | BKFAHEXWLGWURX-KMZFAHPDSA-N |
| XLogP | 5.73 |
| TPSA | 106.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.93 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|