C25H17N3O5 — CID 137076735
(15R,19R)-17-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 137076735) has the molecular formula C25H17N3O5 and a molecular weight of 439.43 g/mol. Its IUPAC name is (15R,19R)-17-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19R)-17-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 137076735 |
| Molecular Formula | C25H17N3O5 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | (15R,19R)-17-[(Z)-(2-hydroxy-5-nitrophenyl)methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@@H]2C3c4ccccc4C(c4ccccc43)[C@H]2C(=O)N1/N=C\c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C25H17N3O5/c29-19-10-9-14(28(32)33)11-13(19)12-26-27-24(30)22-20-15-5-1-2-6-16(15)21(23(22)25(27)31)18-8-4-3-7-17(18)20/h1-12,20-23,29H/b26-12-/t20?,21?,22-,23-/m1/s1 |
| InChIKey | JFMNITHTRWYMMQ-UFWRFDFGSA-N |
| XLogP | 3.53 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|