C25H16I2N2O3 — CID 137170309
(15R,19R)-17-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 137170309) has the molecular formula C25H16I2N2O3 and a molecular weight of 646.22 g/mol. Its IUPAC name is (15R,19R)-17-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19R)-17-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 137170309 |
| Molecular Formula | C25H16I2N2O3 |
| Molecular Weight | 646.22 g/mol |
| Exact Mass | 645.93 |
| IUPAC Name | (15R,19R)-17-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@@H]2C3c4ccccc4C(c4ccccc43)[C@H]2C(=O)N1/N=C\c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C25H16I2N2O3/c26-13-9-12(23(30)18(27)10-13)11-28-29-24(31)21-19-14-5-1-2-6-15(14)20(22(21)25(29)32)17-8-4-3-7-16(17)19/h1-11,19-22,30H/b28-11-/t19?,20?,21-,22-/m1/s1 |
| InChIKey | HLOGUMGOQAEFGM-VIFJEZQQSA-N |
| XLogP | 4.83 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.22 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|