C18H14I2N2O3 — CID 137138030
(1S,2R,6S,7S,8R,10R)-4-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 137138030) has the molecular formula C18H14I2N2O3 and a molecular weight of 560.13 g/mol. Its IUPAC name is (1S,2R,6S,7S,8R,10R)-4-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7S,8R,10R)-4-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 137138030 |
| Molecular Formula | C18H14I2N2O3 |
| Molecular Weight | 560.13 g/mol |
| Exact Mass | 559.91 |
| IUPAC Name | (1S,2R,6S,7S,8R,10R)-4-[(Z)-(2-hydroxy-3,5-diiodophenyl)methylideneamino]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H]3C=C[C@@H]([C@@H]4C[C@@H]34)[C@@H]2C(=O)N1/N=C\c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C18H14I2N2O3/c19-8-3-7(16(23)13(20)4-8)6-21-22-17(24)14-9-1-2-10(12-5-11(9)12)15(14)18(22)25/h1-4,6,9-12,14-15,23H,5H2/b21-6-/t9-,10-,11-,12-,14-,15+/m0/s1 |
| InChIKey | XIZVPALZHPHAJJ-YIGWOZTJSA-N |
| XLogP | 2.99 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.13 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|