C26H17ClN2O4 — CID 126150723
(15R,19R)-17-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 126150723) has the molecular formula C26H17ClN2O4 and a molecular weight of 456.89 g/mol. Its IUPAC name is (15R,19R)-17-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19R)-17-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 126150723 |
| Molecular Formula | C26H17ClN2O4 |
| Molecular Weight | 456.89 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | (15R,19R)-17-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@@H]2C3c4ccccc4C(c4ccccc43)[C@H]2C(=O)N1/N=C\c1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C26H17ClN2O4/c27-18-10-20-19(32-12-33-20)9-13(18)11-28-29-25(30)23-21-14-5-1-2-6-15(14)22(24(23)26(29)31)17-8-4-3-7-16(17)21/h1-11,21-24H,12H2/b28-11-/t21?,22?,23-,24-/m1/s1 |
| InChIKey | JVRWBFQWMNOPRJ-SSONQIPWSA-N |
| XLogP | 4.29 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.89 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|