C29H18Cl2N2O3 — CID 26477901
(15R,19R)-17-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 26477901) has the molecular formula C29H18Cl2N2O3 and a molecular weight of 513.38 g/mol. Its IUPAC name is (15R,19R)-17-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19R)-17-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 26477901 |
| Molecular Formula | C29H18Cl2N2O3 |
| Molecular Weight | 513.38 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | (15R,19R)-17-[(Z)-[5-(2,3-dichlorophenyl)furan-2-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@@H]2C3c4ccccc4C(c4ccccc43)[C@H]2C(=O)N1/N=C\c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C29H18Cl2N2O3/c30-21-11-5-10-20(27(21)31)22-13-12-15(36-22)14-32-33-28(34)25-23-16-6-1-2-7-17(16)24(26(25)29(33)35)19-9-4-3-8-18(19)23/h1-14,23-26H/b32-14-/t23?,24?,25-,26-/m1/s1 |
| InChIKey | KXVFZDOLQHTRMD-LYSBCLPMSA-N |
| XLogP | 6.48 |
| TPSA | 62.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.38 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|