C37H28N4O4 — CID 124558761
(15S,19R)-17-[(Z)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 124558761) has the molecular formula C37H28N4O4 and a molecular weight of 592.66 g/mol. Its IUPAC name is (15S,19R)-17-[(Z)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19R)-17-[(Z)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 124558761 |
| Molecular Formula | C37H28N4O4 |
| Molecular Weight | 592.66 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | (15S,19R)-17-[(Z)-[2,5-dimethyl-1-[4-(4-nitrophenyl)phenyl]pyrrol-3-yl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | Cc1cc(/C=N\N2C(=O)[C@@H]3C4c5ccccc5C(c5ccccc54)[C@@H]3C2=O)c(C)n1-c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C37H28N4O4/c1-21-19-25(22(2)39(21)26-15-11-23(12-16-26)24-13-17-27(18-14-24)41(44)45)20-38-40-36(42)34-32-28-7-3-4-8-29(28)33(35(34)37(40)43)31-10-6-5-9-30(31)32/h3-20,32-35H,1-2H3/b38-20-/t32?,33?,34-,35+ |
| InChIKey | RABGYGDRFUOZPW-GGHZCMHHSA-N |
| XLogP | 6.90 |
| TPSA | 97.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.66 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|