C14H8ClN3O4S2 — CID 126341056
3-[(E)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126341056) has the molecular formula C14H8ClN3O4S2 and a molecular weight of 381.82 g/mol. Its IUPAC name is 3-[(E)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[(E)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126341056 |
| Molecular Formula | C14H8ClN3O4S2 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 380.96 |
| IUPAC Name | 3-[(E)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=S)N1/N=C/c1ccc(-c2cc([N+](=O)[O-])ccc2Cl)o1 |
| InChI | InChI=1S/C14H8ClN3O4S2/c15-11-3-1-8(18(20)21)5-10(11)12-4-2-9(22-12)6-16-17-13(19)7-24-14(17)23/h1-6H,7H2/b16-6+ |
| InChIKey | WZKQCHGYWLQMQX-OMCISZLKSA-N |
| XLogP | 3.70 |
| TPSA | 88.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|