C19H14ClNO3 — CID 963942
methyl 2-[5-[(4-chlorophenyl)iminomethyl]furan-2-yl]benzoate (PubChem CID 963942) has the molecular formula C19H14ClNO3 and a molecular weight of 339.78 g/mol. Its IUPAC name is methyl 2-[5-[(4-chlorophenyl)iminomethyl]furan-2-yl]benzoate.
| Compound Name | methyl 2-[5-[(4-chlorophenyl)iminomethyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 963942 |
| Molecular Formula | C19H14ClNO3 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | methyl 2-[5-[(4-chlorophenyl)iminomethyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-c1ccc(/C=N/c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C19H14ClNO3/c1-23-19(22)17-5-3-2-4-16(17)18-11-10-15(24-18)12-21-14-8-6-13(20)7-9-14/h2-12H,1H3/b21-12+ |
| InChIKey | HITCYCUYGZISCR-CIAFOILYSA-N |
| XLogP | 5.14 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|