C21H14O4S — CID 50883648
methyl 2-[5-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 50883648) has the molecular formula C21H14O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is methyl 2-[5-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | methyl 2-[5-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 50883648 |
| Molecular Formula | C21H14O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | methyl 2-[5-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-c1ccc(/C=C2\Sc3ccccc3C2=O)o1 |
| InChI | InChI=1S/C21H14O4S/c1-24-21(23)15-7-3-2-6-14(15)17-11-10-13(25-17)12-19-20(22)16-8-4-5-9-18(16)26-19/h2-12H,1H3/b19-12- |
| InChIKey | WLXCQGZDHDXCIZ-UNOMPAQXSA-N |
| XLogP | 5.06 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|