C20H11ClO4S — CID 176602237
4-chloro-3-[5-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 176602237) has the molecular formula C20H11ClO4S and a molecular weight of 382.82 g/mol. Its IUPAC name is 4-chloro-3-[5-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-chloro-3-[5-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 176602237 |
| Molecular Formula | C20H11ClO4S |
| Molecular Weight | 382.82 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | 4-chloro-3-[5-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(-c2ccc(/C=C3\Sc4ccccc4C3=O)o2)c1 |
| InChI | InChI=1S/C20H11ClO4S/c21-15-7-5-11(20(23)24)9-14(15)16-8-6-12(25-16)10-18-19(22)13-3-1-2-4-17(13)26-18/h1-10H,(H,23,24)/b18-10- |
| InChIKey | ZAIJEFRSGGUKBX-ZDLGFXPLSA-N |
| XLogP | 5.63 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.82 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|