C20H10ClF3O2S — CID 4532460
2-[[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1-benzothiophen-3-one (PubChem CID 4532460) has the molecular formula C20H10ClF3O2S and a molecular weight of 406.81 g/mol. Its IUPAC name is 2-[[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1-benzothiophen-3-one.
| Compound Name | 2-[[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 4532460 |
| Molecular Formula | C20H10ClF3O2S |
| Molecular Weight | 406.81 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | 2-[[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]-1-benzothiophen-3-one |
| SMILES | O=C1C(=Cc2ccc(-c3ccc(Cl)c(C(F)(F)F)c3)o2)Sc2ccccc21 |
| InChI | InChI=1S/C20H10ClF3O2S/c21-15-7-5-11(9-14(15)20(22,23)24)16-8-6-12(26-16)10-18-19(25)13-3-1-2-4-17(13)27-18/h1-10H |
| InChIKey | YNZMKRXCGQYBAP-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.81 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|