C14H10O3S — CID 138675424
(2Z)-2-[[5-(hydroxymethyl)furan-2-yl]methylidene]-1-benzothiophen-3-one (PubChem CID 138675424) has the molecular formula C14H10O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is (2Z)-2-[[5-(hydroxymethyl)furan-2-yl]methylidene]-1-benzothiophen-3-one.
| Compound Name | (2Z)-2-[[5-(hydroxymethyl)furan-2-yl]methylidene]-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 138675424 |
| Molecular Formula | C14H10O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | (2Z)-2-[[5-(hydroxymethyl)furan-2-yl]methylidene]-1-benzothiophen-3-one |
| SMILES | O=C1/C(=C/c2ccc(CO)o2)Sc2ccccc21 |
| InChI | InChI=1S/C14H10O3S/c15-8-10-6-5-9(17-10)7-13-14(16)11-3-1-2-4-12(11)18-13/h1-7,15H,8H2/b13-7- |
| InChIKey | QLHCWWNPZHYCFO-QPEQYQDCSA-N |
| XLogP | 3.10 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|