C26H18N2O4S — CID 168893620
2-hydroxy-5-[5-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]furan-2-yl]-N'-phenylbenzohydrazide (PubChem CID 168893620) has the molecular formula C26H18N2O4S and a molecular weight of 454.51 g/mol. Its IUPAC name is 2-hydroxy-5-[5-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]furan-2-yl]-N'-phenylbenzohydrazide.
| Compound Name | 2-hydroxy-5-[5-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]furan-2-yl]-N'-phenylbenzohydrazide |
|---|---|
| PubChem CID | 168893620 |
| Molecular Formula | C26H18N2O4S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 2-hydroxy-5-[5-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]furan-2-yl]-N'-phenylbenzohydrazide |
| SMILES | O=C(NNc1ccccc1)c1cc(-c2ccc(/C=C3\Sc4ccccc4C3=O)o2)ccc1O |
| InChI | InChI=1S/C26H18N2O4S/c29-21-12-10-16(14-20(21)26(31)28-27-17-6-2-1-3-7-17)22-13-11-18(32-22)15-24-25(30)19-8-4-5-9-23(19)33-24/h1-15,27,29H,(H,28,31)/b24-15- |
| InChIKey | GBDDDFXSUWRHQJ-IWIPYMOSSA-N |
| XLogP | 5.74 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|