C25H23NO4S — CID 168893579
N-ethyl-5-[5-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]furan-2-yl]-2-propoxybenzamide (PubChem CID 168893579) has the molecular formula C25H23NO4S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-ethyl-5-[5-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]furan-2-yl]-2-propoxybenzamide.
| Compound Name | N-ethyl-5-[5-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]furan-2-yl]-2-propoxybenzamide |
|---|---|
| PubChem CID | 168893579 |
| Molecular Formula | C25H23NO4S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-ethyl-5-[5-[(Z)-(3-oxo-1-benzothiophen-2-ylidene)methyl]furan-2-yl]-2-propoxybenzamide |
| SMILES | CCCOc1ccc(-c2ccc(/C=C3\Sc4ccccc4C3=O)o2)cc1C(=O)NCC |
| InChI | InChI=1S/C25H23NO4S/c1-3-13-29-21-11-9-16(14-19(21)25(28)26-4-2)20-12-10-17(30-20)15-23-24(27)18-7-5-6-8-22(18)31-23/h5-12,14-15H,3-4,13H2,1-2H3,(H,26,28)/b23-15- |
| InChIKey | XVRCLGIWZWSVCP-HAHDFKILSA-N |
| XLogP | 5.81 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|