C19H10F2O2S — CID 700355
2-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-1-benzothiophen-3-one (PubChem CID 700355) has the molecular formula C19H10F2O2S and a molecular weight of 340.35 g/mol. Its IUPAC name is 2-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-1-benzothiophen-3-one.
| Compound Name | 2-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 700355 |
| Molecular Formula | C19H10F2O2S |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 2-[[5-(2,4-difluorophenyl)furan-2-yl]methylidene]-1-benzothiophen-3-one |
| SMILES | O=C1C(=Cc2ccc(-c3ccc(F)cc3F)o2)Sc2ccccc21 |
| InChI | InChI=1S/C19H10F2O2S/c20-11-5-7-13(15(21)9-11)16-8-6-12(23-16)10-18-19(22)14-3-1-2-4-17(14)24-18/h1-10H |
| InChIKey | FXNZBXAKIUUDOL-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|