C19H15NO7S — CID 2178482
methyl 2-[5-[(Z)-[3-(2-methoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 2178482) has the molecular formula C19H15NO7S and a molecular weight of 401.40 g/mol. Its IUPAC name is methyl 2-[5-[(Z)-[3-(2-methoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 2-[5-[(Z)-[3-(2-methoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 2178482 |
| Molecular Formula | C19H15NO7S |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | methyl 2-[5-[(Z)-[3-(2-methoxy-2-oxoethyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)CN1C(=O)S/C(=C\c2ccc(-c3ccccc3C(=O)OC)o2)C1=O |
| InChI | InChI=1S/C19H15NO7S/c1-25-16(21)10-20-17(22)15(28-19(20)24)9-11-7-8-14(27-11)12-5-3-4-6-13(12)18(23)26-2/h3-9H,10H2,1-2H3/b15-9- |
| InChIKey | ZBGOEHJUVDCVDF-DHDCSXOGSA-N |
| XLogP | 2.94 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|