C19H15NO6S — CID 75337201
methyl 2-[5-[[5-(4-acetylphenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 75337201) has the molecular formula C19H15NO6S and a molecular weight of 385.40 g/mol. Its IUPAC name is methyl 2-[5-[[5-(4-acetylphenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | methyl 2-[5-[[5-(4-acetylphenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 75337201 |
| Molecular Formula | C19H15NO6S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | methyl 2-[5-[[5-(4-acetylphenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | COC(=O)CN1C(=O)SC(=Cc2ccc(-c3ccc(C(C)=O)cc3)o2)C1=O |
| InChI | InChI=1S/C19H15NO6S/c1-11(21)12-3-5-13(6-4-12)15-8-7-14(26-15)9-16-18(23)20(19(24)27-16)10-17(22)25-2/h3-9H,10H2,1-2H3 |
| InChIKey | HCMXNKJXMGZGQF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|