C24H17BrN2O5S — CID 126351053
2-[(5E)-5-[[5-(4-acetylphenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-bromophenyl)acetamide (PubChem CID 126351053) has the molecular formula C24H17BrN2O5S and a molecular weight of 525.38 g/mol. Its IUPAC name is 2-[(5E)-5-[[5-(4-acetylphenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-bromophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[5-(4-acetylphenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-bromophenyl)acetamide |
|---|---|
| PubChem CID | 126351053 |
| Molecular Formula | C24H17BrN2O5S |
| Molecular Weight | 525.38 g/mol |
| Exact Mass | 524.00 |
| IUPAC Name | 2-[(5E)-5-[[5-(4-acetylphenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-bromophenyl)acetamide |
| SMILES | CC(=O)c1ccc(-c2ccc(/C=C3/SC(=O)N(CC(=O)Nc4ccccc4Br)C3=O)o2)cc1 |
| InChI | InChI=1S/C24H17BrN2O5S/c1-14(28)15-6-8-16(9-7-15)20-11-10-17(32-20)12-21-23(30)27(24(31)33-21)13-22(29)26-19-5-3-2-4-18(19)25/h2-12H,13H2,1H3,(H,26,29)/b21-12+ |
| InChIKey | JSNJKVOFLQEORV-CIAFOILYSA-N |
| XLogP | 5.59 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.38 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|