C24H16N2O4S — CID 126158350
2-[[(5E)-5-[[5-(4-acetylphenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile (PubChem CID 126158350) has the molecular formula C24H16N2O4S and a molecular weight of 428.47 g/mol. Its IUPAC name is 2-[[(5E)-5-[[5-(4-acetylphenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile.
| Compound Name | 2-[[(5E)-5-[[5-(4-acetylphenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126158350 |
| Molecular Formula | C24H16N2O4S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 2-[[(5E)-5-[[5-(4-acetylphenyl)furan-2-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzonitrile |
| SMILES | CC(=O)c1ccc(-c2ccc(/C=C3/SC(=O)N(Cc4ccccc4C#N)C3=O)o2)cc1 |
| InChI | InChI=1S/C24H16N2O4S/c1-15(27)16-6-8-17(9-7-16)21-11-10-20(30-21)12-22-23(28)26(24(29)31-22)14-19-5-3-2-4-18(19)13-25/h2-12H,14H2,1H3/b22-12+ |
| InChIKey | IVOUOEUAOQRSLQ-WSDLNYQXSA-N |
| XLogP | 5.26 |
| TPSA | 91.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|