C22H12Cl2N2O3S — CID 124666166
2-[5-[(E)-[3-[(2,6-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile (PubChem CID 124666166) has the molecular formula C22H12Cl2N2O3S and a molecular weight of 455.32 g/mol. Its IUPAC name is 2-[5-[(E)-[3-[(2,6-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile.
| Compound Name | 2-[5-[(E)-[3-[(2,6-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 124666166 |
| Molecular Formula | C22H12Cl2N2O3S |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 453.99 |
| IUPAC Name | 2-[5-[(E)-[3-[(2,6-dichlorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzonitrile |
| SMILES | N#Cc1ccccc1-c1ccc(/C=C2/SC(=O)N(Cc3c(Cl)cccc3Cl)C2=O)o1 |
| InChI | InChI=1S/C22H12Cl2N2O3S/c23-17-6-3-7-18(24)16(17)12-26-21(27)20(30-22(26)28)10-14-8-9-19(29-14)15-5-2-1-4-13(15)11-25/h1-10H,12H2/b20-10+ |
| InChIKey | BMSSQUGRDSZMQF-KEBDBYFISA-N |
| XLogP | 6.36 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|