C22H13Cl2NO5S — CID 1495006
(5E)-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 1495006) has the molecular formula C22H13Cl2NO5S and a molecular weight of 474.32 g/mol. Its IUPAC name is (5E)-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1495006 |
| Molecular Formula | C22H13Cl2NO5S |
| Molecular Weight | 474.32 g/mol |
| Exact Mass | 472.99 |
| IUPAC Name | (5E)-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-5-[[5-(2-chlorophenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccc(-c3ccccc3Cl)o2)C(=O)N1Cc1cc2c(cc1Cl)OCO2 |
| InChI | InChI=1S/C22H13Cl2NO5S/c23-15-4-2-1-3-14(15)17-6-5-13(30-17)8-20-21(26)25(22(27)31-20)10-12-7-18-19(9-16(12)24)29-11-28-18/h1-9H,10-11H2/b20-8+ |
| InChIKey | ZEIIBHPOHSEEMV-DNTJNYDQSA-N |
| XLogP | 6.22 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.32 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|