C23H15BrClNO5S — CID 4083652
5-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 4083652) has the molecular formula C23H15BrClNO5S and a molecular weight of 532.80 g/mol. Its IUPAC name is 5-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 4083652 |
| Molecular Formula | C23H15BrClNO5S |
| Molecular Weight | 532.80 g/mol |
| Exact Mass | 530.95 |
| IUPAC Name | 5-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(-c2ccc(C=C3SC(=O)N(Cc4cc5c(cc4Cl)OCO5)C3=O)o2)c(Br)c1 |
| InChI | InChI=1S/C23H15BrClNO5S/c1-12-2-4-15(16(24)6-12)18-5-3-14(31-18)8-21-22(27)26(23(28)32-21)10-13-7-19-20(9-17(13)25)30-11-29-19/h2-9H,10-11H2,1H3 |
| InChIKey | DYWIFOHHFOHYKO-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.80 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|