C19H13BrClNO6S — CID 124640819
(5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 124640819) has the molecular formula C19H13BrClNO6S and a molecular weight of 498.74 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124640819 |
| Molecular Formula | C19H13BrClNO6S |
| Molecular Weight | 498.74 g/mol |
| Exact Mass | 496.93 |
| IUPAC Name | (5E)-5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/SC(=O)N(Cc3cc4c(cc3Cl)OCO4)C2=O)cc(Br)c1O |
| InChI | InChI=1S/C19H13BrClNO6S/c1-26-15-3-9(2-11(20)17(15)23)4-16-18(24)22(19(25)29-16)7-10-5-13-14(6-12(10)21)28-8-27-13/h2-6,23H,7-8H2,1H3/b16-4+ |
| InChIKey | JEXGMVUOHJPUAI-AYSLTRBKSA-N |
| XLogP | 4.78 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.74 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|